Skip to main content

Fst

FSTF_{ST} is a statistical measure used to quantify the degree of genetic differentiation or genetic structure among populations.

FSTF_{ST} is calculated based on the genetic variation within and between populations. It typically ranges from 0 to 1, with higher values indicating greater genetic differentiation.

When FSTF_{ST} is 0, it means that there is no genetic differentiation between populations (all populations have identical allele frequencies). So in a sense all the genetic diversity is within the populations. In contrast, when FSTF_{ST} is 1, it indicates complete genetic differentiation, with no shared genetic variation between populations.

FSTF_{ST} is conceptually a number that applies to whole populations - while what we typically have is data on a smaller sample of individuals. To handle this there are several different formula that estimate FSTF_{ST} - surveyed in Bhatia et al 2013 Here, we adopt the estimation approach from Hudson et al. 1992.

Assume we have two populations pop1 and pop2. Hudson's FSTF_{ST} can be calculated by:

FSTHudson=(p1p2)2p1(1p1)n11p2(1p2)n21p1(1p2)+p2(1p1)F_{ST}^{Hudson} = \frac{(p1-p2)^2 -\frac{p_1(1-p_1)}{n_1-1}-\frac{p_2(1-p_2)}{n_2-1}}{p_1(1-p_2) + p_2(1-p_1)}

where nin_i is the sample size of population ii and pip_i is the sample allele frequency in population ii. This formula applies to a single variant - it answers 'how differentiated is this variant between the two populations'? A simple way to ask 'how differentiated are the populations' is to average this value across a large set of variants, and that's what we'll do.

Let's code it in R:

Setting up R environment

library( tidyverse )
library( ggplot2 )
library( ggpubr )
library( vcfR )

Here is a function to compute Hudson's estimator of FSTF_{ST}. We'll actually extend a little bit to compute the *mean FSTF_{ST} between multiple populsion

Hudson_Fst <- function( p1, p2, n1, n2 ) {
numerator = (p1-p2)^2 - p1*(1-p1)/(n1-1) - p2*(1-p2)/(n2-1)
denominator = p1*(1-p2) + p2*(1-p1)
hudson = numerator / denominator
# before taking the man, let's get rid of any monomorphic variants!
hudson = hudson[denominator != 0]
return( mean( hudson) )
}

Calculate Fst using common chr21 genotypes from the 1000 Genomes Project

# read in genotypes (10,000 randomly selected common marker in 1000 Genome Project)
chr21 <- read.table("g1k_common_genotypes.txt",h=T,stringsAsFactors = F)
dim(chr21)

# now let's load the sample ancestry information
pop <- read.table("integrated_call_samples_v3.20130502.ALL.panel",h=T,stringsAsFactors = F)

#simplify sample names
samples <- unlist(lapply(names(chr21), function(x) unlist(strsplit(x, split = "_"))[1]))

FSTF_{ST} between European and East Asian individuals

# subset only European samples and get genotypes
eur <- pop[pop$super_pop=="EUR",]$sample
eurGeno <- chr21[,samples %in% eur]

# subset only East Asian samples and get genotypes
eas <- pop[pop$super_pop=="EAS",]$sample
easGeno <- chr21[,samples %in% eas]

# Obtain frequencies of 10,000 variants
eurFreq <- rowSums( eurGeno ) / (2*ncol(eurGeno))
easFreq <- rowSums( easGeno ) / (2*ncol(easGeno))

## Calculate Hudson Fst
Fst_eur_eas <- Hudson_Fst(p1 = eurFreq,p2 = easFreq, n1=length(eur),n2=length(eas))
print(paste("Fst between European and East Asian is", signif(Fst_eur_eas,2)))

FSTF_{ST} between European and African individuals

Interesting! Now let's try measuring between African and European individuals:

# subset only African samples and get genotypes
afr <- pop[pop$super_pop=="AFR",]$sample
afrGeno <- chr21[,samples %in% afr]

# SNP frequency among African individuals
afrFreq <- rowSums( afrGeno ) / (1*ncol(afrGeno))

## Calculate Hudson Fst
Fst_eur_afr <- Hudson_Fst(p1 = eurFreq,p2 = afrFreq, n1=length(eur),n2=length(afr))

print(paste("Fst between European and African is", signif(Fst_eur_afr,2)))

FSTF_{ST} between East Asian and African individuals

Fst_eas_afr <- Hudson_Fst(p1 = easFreq,p2 = afrFreq, n1=length(eas),n2=length(afr))

print(paste("Fst between East Asian and African is", signif(Fst_eas_afr,2)))

The choice of markers affects Fst

You should note that all these values are relative to the set of markers chosen.

For example, what happens if we randomly pick 1000 markers?

idx <- sample( 1:nrow(chr21), size=1000 )

# Calcuate Hudson Fst
Fst_eur_afr <- Hudson_Fst(p1 = eurFreq[idx],p2 = afrFreq[idx], n1=length(eur),n2=length(afr))
Fst_eur_eas <- Hudson_Fst(p1 = eurFreq[idx],p2 = easFreq[idx], n1=length(eur),n2=length(eas))
Fst_eas_afr <- Hudson_Fst(p1 = easFreq[idx],p2 = afrFreq[idx], n1=length(eas),n2=length(afr))


print(paste("Fst between European and East Asian is", signif(Fst_eur_eas,2)))
print(paste("Fst between European and African is", signif(Fst_eur_afr,2)))
print(paste("Fst between East Asian and African is", signif(Fst_eas_afr,2)))

If you run this a few times, you should see slightly different values.

Fst between populations within a continent

How differentiated are populations within continents?

# see how many subpoputions were collected  within Europe
table( pop[pop$super_pop == "AFR",]$pop )

# let's caculate Fst between UK (GBR) and Finland (FIN)
# subset only GBR & FIN samples
gbr <- pop[pop$pop=="GBR",]$sample
fin <- pop[pop$pop=="FIN",]$sample

# GBR & FIN genotypes
gbrGeno <- chr21[, samples %in% gbr]
finGeno <- chr21[, samples %in% fin]

# Obtain frequencies of 10,000 variants

gbrFreq <- rowSums( gbrGeno ) / (2*ncol(gbrGeno))
finFreq <- rowSums( gbrGeno ) / (2*ncol(gbrGeno))

# Calculate Fst
Fst_gbr_fin <- Hudson_Fst(p1 = gbrFreq,p2 = finFreq, n1=length(gbr),n2=length(fin))

print(paste("Fst between Britain and Finland is", signif(Fst_gbr_fin,2)))

When I run this, my answer is negative!

Interpreting negative Fst

If you are getting a negative Fst, don't panic! Remember we are making an estimate of the FSTF_{ST} between the populations. The estimate varies due to sampling noise and can be negative (or greater than 11). In this case you could reasonably treat the estimate as zero. i.e. the two populations don't have much differentiation.

Note

Of course this is not true - British and Finnish individuals are genetically different! This only means, among the common genetic variants (in Chromosome 21) that we used, there is no detectable differences. This shows that FSTF_{ST} computed this way is only a relative measure, and depends on what the input variants are. It's NOT an absolute value!